C9H12ClN — CID 130291337
2-chloro-N,3,4-trimethylaniline (PubChem CID 130291337) has the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. Its IUPAC name is 2-chloro-N,3,4-trimethylaniline.
| Compound Name | 2-chloro-N,3,4-trimethylaniline |
|---|---|
| PubChem CID | 130291337 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-chloro-N,3,4-trimethylaniline |
| SMILES | CNc1ccc(C)c(C)c1Cl |
| InChI | InChI=1S/C9H12ClN/c1-6-4-5-8(11-3)9(10)7(6)2/h4-5,11H,1-3H3 |
| InChIKey | BCQWDCUWVZIQIZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |