C15H31NO — CID 143680680
2,3-dimethyl-6-(methylamino)phenol;ethane (PubChem CID 143680680) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 2,3-dimethyl-6-(methylamino)phenol;ethane.
| Compound Name | 2,3-dimethyl-6-(methylamino)phenol;ethane |
|---|---|
| PubChem CID | 143680680 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 2,3-dimethyl-6-(methylamino)phenol;ethane |
| SMILES | CC.CC.CC.CNc1ccc(C)c(C)c1O |
| InChI | InChI=1S/C9H13NO.3C2H6/c1-6-4-5-8(10-3)9(11)7(6)2;3*1-2/h4-5,10-11H,1-3H3;3*1-2H3 |
| InChIKey | JMSIWVHASPWMOL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|