C35H41NO2 — CID 130292236
(1R,9S,13S)-10-(cyclopropylmethyl)-N-[2-[4-(3-methoxyphenyl)phenyl]ethyl]-1,13-dimethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 130292236) has the molecular formula C35H41NO2 and a molecular weight of 507.72 g/mol. Its IUPAC name is (1R,9S,13S)-10-(cyclopropylmethyl)-N-[2-[4-(3-methoxyphenyl)phenyl]ethyl]-1,13-dimethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1R,9S,13S)-10-(cyclopropylmethyl)-N-[2-[4-(3-methoxyphenyl)phenyl]ethyl]-1,13-dimethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 130292236 |
| Molecular Formula | C35H41NO2 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (1R,9S,13S)-10-(cyclopropylmethyl)-N-[2-[4-(3-methoxyphenyl)phenyl]ethyl]-1,13-dimethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | COc1cccc(-c2ccc(CCNC(=O)c3ccc4c(c3)[C@]3(C)CCC(CC5CC5)[C@H](C4)[C@@H]3C)cc2)c1 |
| InChI | InChI=1S/C35H41NO2/c1-23-32-21-29-13-14-30(22-33(29)35(23,2)17-15-28(32)19-25-7-8-25)34(37)36-18-16-24-9-11-26(12-10-24)27-5-4-6-31(20-27)38-3/h4-6,9-14,20,22-23,25,28,32H,7-8,15-19,21H2,1-3H3,(H,36,37)/t23-,28?,32+,35+/m0/s1 |
| InChIKey | LXNSKGVTSFBSNT-FTZYVDIASA-N |
| XLogP | 7.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |