C19H23N6O12P — CID 130297047
(2S)-2-[[[2-[[(2R,3S,4R,5R)-2-azido-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phenyl]peroxy-hydroxyphosphoryl]amino]propanoic acid (PubChem CID 130297047) has the molecular formula C19H23N6O12P and a molecular weight of 558.40 g/mol. Its IUPAC name is (2S)-2-[[[2-[[(2R,3S,4R,5R)-2-azido-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phenyl]peroxy-hydroxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[2-[[(2R,3S,4R,5R)-2-azido-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phenyl]peroxy-hydroxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 130297047 |
| Molecular Formula | C19H23N6O12P |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | (2S)-2-[[[2-[[(2R,3S,4R,5R)-2-azido-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phenyl]peroxy-hydroxyphosphoryl]amino]propanoic acid |
| SMILES | Cc1cn([C@@H]2O[C@@](COc3ccccc3OOP(=O)(O)N[C@@H](C)C(=O)O)(N=[N+]=[N-])[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H23N6O12P/c1-9-7-25(18(31)21-15(9)28)16-13(26)14(27)19(35-16,23-24-20)8-34-11-5-3-4-6-12(11)36-37-38(32,33)22-10(2)17(29)30/h3-7,10,13-14,16,26-27H,8H2,1-2H3,(H,29,30)(H,21,28,31)(H2,22,32,33)/t10-,13+,14-,16+,19+/m0/s1 |
| InChIKey | KNQSFMWKMXQXBU-KFXRPREASA-N |
| XLogP | -0.35 |
| TPSA | 267.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|