C24H25F2N7O3 — CID 130301369
2-[3-(difluoromethoxy)-3-(dimethylamino)propyl]-1-N-[4-(1H-indol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine (PubChem CID 130301369) has the molecular formula C24H25F2N7O3 and a molecular weight of 497.51 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-3-(dimethylamino)propyl]-1-N-[4-(1H-indol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine.
| Compound Name | 2-[3-(difluoromethoxy)-3-(dimethylamino)propyl]-1-N-[4-(1H-indol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 130301369 |
| Molecular Formula | C24H25F2N7O3 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-[3-(difluoromethoxy)-3-(dimethylamino)propyl]-1-N-[4-(1H-indol-3-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
| SMILES | CN(C)C(CCc1cc(N)c([N+](=O)[O-])cc1Nc1nccc(-c2c[nH]c3ccccc23)n1)OC(F)F |
| InChI | InChI=1S/C24H25F2N7O3/c1-32(2)22(36-23(25)26)8-7-14-11-17(27)21(33(34)35)12-20(14)31-24-28-10-9-19(30-24)16-13-29-18-6-4-3-5-15(16)18/h3-6,9-13,22-23,29H,7-8,27H2,1-2H3,(H,28,30,31) |
| InChIKey | MAJLBMYNTSXSAU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|