C12H19Br — CID 130305948
3-bromo-9-methyltricyclo[5.3.1.04,9]undecane (PubChem CID 130305948) has the molecular formula C12H19Br and a molecular weight of 243.19 g/mol. Its IUPAC name is 3-bromo-9-methyltricyclo[5.3.1.04,9]undecane.
| Compound Name | 3-bromo-9-methyltricyclo[5.3.1.04,9]undecane |
|---|---|
| PubChem CID | 130305948 |
| Molecular Formula | C12H19Br |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-bromo-9-methyltricyclo[5.3.1.04,9]undecane |
| SMILES | CC12CC3CCC1C(Br)CC(C3)C2 |
| InChI | InChI=1S/C12H19Br/c1-12-6-8-2-3-10(12)11(13)5-9(4-8)7-12/h8-11H,2-7H2,1H3 |
| InChIKey | PLGUTWNQJMEVAT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|