About 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol
3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol (PubChem CID 149051816) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol.
Molecular Properties
| Compound Name | 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol |
| PubChem CID | 149051816 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol |
| SMILES | CCOC1CC2CC3CCC1C(O)(C3)C2 |
| InChI | InChI=1S/C13H22O2/c1-2-15-12-6-10-5-9-3-4-11(12)13(14,7-9)8-10/h9-12,14H,2-8H2,1H3 |
| InChIKey | QJYVGOPVNDWPEL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol?
The IUPAC name of 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol (CID 149051816) is 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol.
What is the SMILES notation for 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol?
The canonical SMILES for 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol is CCOC1CC2CC3CCC1C(O)(C3)C2.
What is the InChIKey of 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol?
The InChIKey is QJYVGOPVNDWPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-2-15-12-6-10-5-9-3-4-11(12)13(14,7-9)8-10/h9-12,14H,2-8H2,1H3.
What are the key properties of 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol?
3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol has a molecular weight of 210.32 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxytricyclo[5.3.1.04,9]undecan-9-ol is sourced from PubChem (CID 149051816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).