C9H15N — CID 130306157
(2Z)-N-methyl-2-propan-2-ylpenta-2,4-dien-1-imine (PubChem CID 130306157) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (2Z)-N-methyl-2-propan-2-ylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-methyl-2-propan-2-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 130306157 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (2Z)-N-methyl-2-propan-2-ylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\C)C(C)C |
| InChI | InChI=1S/C9H15N/c1-5-6-9(7-10-4)8(2)3/h5-8H,1H2,2-4H3/b9-6+,10-7+ |
| InChIKey | MRNSBOCPYQCBDQ-KZZDLZNXSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|