C9H14N14O — CID 130311388
2-[5-[[6-[(2-propyltetrazol-5-yl)amino]-1,2,4,5-tetrazin-3-yl]amino]tetrazol-2-yl]ethanol (PubChem CID 130311388) has the molecular formula C9H14N14O and a molecular weight of 334.31 g/mol. Its IUPAC name is 2-[5-[[6-[(2-propyltetrazol-5-yl)amino]-1,2,4,5-tetrazin-3-yl]amino]tetrazol-2-yl]ethanol.
| Compound Name | 2-[5-[[6-[(2-propyltetrazol-5-yl)amino]-1,2,4,5-tetrazin-3-yl]amino]tetrazol-2-yl]ethanol |
|---|---|
| PubChem CID | 130311388 |
| Molecular Formula | C9H14N14O |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[5-[[6-[(2-propyltetrazol-5-yl)amino]-1,2,4,5-tetrazin-3-yl]amino]tetrazol-2-yl]ethanol |
| SMILES | CCCn1nnc(Nc2nnc(Nc3nnn(CCO)n3)nn2)n1 |
| InChI | InChI=1S/C9H14N14O/c1-2-3-22-18-8(16-20-22)10-6-12-14-7(15-13-6)11-9-17-21-23(19-9)4-5-24/h24H,2-5H2,1H3,(H,10,12,13,18)(H,11,14,15,19) |
| InChIKey | CLEHIIKMMSTTNI-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 183.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|