C7H5N4OP — CID 130335747
7-oxo-6-phosphanyl-5H-pyrrolo[3,4-d]pyrimidine-2-carbonitrile (PubChem CID 130335747) has the molecular formula C7H5N4OP and a molecular weight of 192.12 g/mol. Its IUPAC name is 7-oxo-6-phosphanyl-5H-pyrrolo[3,4-d]pyrimidine-2-carbonitrile.
| Compound Name | 7-oxo-6-phosphanyl-5H-pyrrolo[3,4-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 130335747 |
| Molecular Formula | C7H5N4OP |
| Molecular Weight | 192.12 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 7-oxo-6-phosphanyl-5H-pyrrolo[3,4-d]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1ncc2c(n1)C(=O)N(P)C2 |
| InChI | InChI=1S/C7H5N4OP/c8-1-5-9-2-4-3-11(13)7(12)6(4)10-5/h2H,3,13H2 |
| InChIKey | MNSRQDXVJJMVQE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.12 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|