About N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide
N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide (PubChem CID 130337496) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide.
Molecular Properties
| Compound Name | N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide |
| PubChem CID | 130337496 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide |
| SMILES | C=CN/C(C/N=C/N)=C(\C)C(=C)C |
| InChI | InChI=1S/C10H17N3/c1-5-13-10(6-12-7-11)9(4)8(2)3/h5,7,13H,1-2,6H2,3-4H3,(H2,11,12)/b10-9+ |
| InChIKey | IGXIHDDMYVANJG-MDZDMXLPSA-N |
| XLogP | 1.56 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide?
The IUPAC name of N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide (CID 130337496) is N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide.
What is the SMILES notation for N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide?
The canonical SMILES for N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide is C=CN/C(C/N=C/N)=C(\C)C(=C)C.
What is the InChIKey of N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide?
The InChIKey is IGXIHDDMYVANJG-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H17N3/c1-5-13-10(6-12-7-11)9(4)8(2)3/h5,7,13H,1-2,6H2,3-4H3,(H2,11,12)/b10-9+.
What are the key properties of N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide?
N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide has a molecular weight of 179.27 g/mol, XLogP of 1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2E)-2-(ethenylamino)-3,4-dimethylpenta-2,4-dienyl]methanimidamide is sourced from PubChem (CID 130337496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).