C24H27ClO8 — CID 130355016
[2-chloro-5-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methyloxan-2-yl]phenyl]-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone (PubChem CID 130355016) has the molecular formula C24H27ClO8 and a molecular weight of 478.93 g/mol. Its IUPAC name is [2-chloro-5-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methyloxan-2-yl]phenyl]-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone.
| Compound Name | [2-chloro-5-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methyloxan-2-yl]phenyl]-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone |
|---|---|
| PubChem CID | 130355016 |
| Molecular Formula | C24H27ClO8 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [2-chloro-5-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methyloxan-2-yl]phenyl]-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone |
| SMILES | CC1(c2ccc(Cl)c(C(=O)c3ccc(O[C@H]4CCOC4)cc3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H27ClO8/c1-24(23(30)22(29)21(28)19(11-26)33-24)14-4-7-18(25)17(10-14)20(27)13-2-5-15(6-3-13)32-16-8-9-31-12-16/h2-7,10,16,19,21-23,26,28-30H,8-9,11-12H2,1H3/t16-,19+,21+,22-,23+,24?/m0/s1 |
| InChIKey | PAXDASJAMISVGU-JIQOUJOZSA-N |
| XLogP | 1.43 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |