C28H35N5O3S — CID 130374774
(E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-1-ene-1-sulfinamide (PubChem CID 130374774) has the molecular formula C28H35N5O3S and a molecular weight of 521.69 g/mol. Its IUPAC name is (E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-1-ene-1-sulfinamide.
| Compound Name | (E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-1-ene-1-sulfinamide |
|---|---|
| PubChem CID | 130374774 |
| Molecular Formula | C28H35N5O3S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | (E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-1-ene-1-sulfinamide |
| SMILES | COCCNS(=O)/C(C#N)=C(\C)c1ccc(-c2ccc3cc(NCCN4CCOCC4)ccc3c2)n1C |
| InChI | InChI=1S/C28H35N5O3S/c1-21(28(20-29)37(34)31-11-15-35-3)26-8-9-27(32(26)2)24-5-4-23-19-25(7-6-22(23)18-24)30-10-12-33-13-16-36-17-14-33/h4-9,18-19,30-31H,10-17H2,1-3H3/b28-21+ |
| InChIKey | GVCJBUXQGWKWRE-SGWCAAJKSA-N |
| XLogP | 3.74 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|