C28H35N4ORe- — CID 153371608
(2Z,4Z)-2-but-1-enyl-4-methyl-3-[1-methyl-5-[4-(2-morpholin-4-ylethylamino)phenyl]pyrrol-2-yl]hexa-2,4-dienenitrile;rhenium (PubChem CID 153371608) has the molecular formula C28H35N4ORe- and a molecular weight of 629.82 g/mol. Its IUPAC name is (2Z,4Z)-2-but-1-enyl-4-methyl-3-[1-methyl-5-[4-(2-morpholin-4-ylethylamino)phenyl]pyrrol-2-yl]hexa-2,4-dienenitrile;rhenium.
| Compound Name | (2Z,4Z)-2-but-1-enyl-4-methyl-3-[1-methyl-5-[4-(2-morpholin-4-ylethylamino)phenyl]pyrrol-2-yl]hexa-2,4-dienenitrile;rhenium |
|---|---|
| PubChem CID | 153371608 |
| Molecular Formula | C28H35N4ORe- |
| Molecular Weight | 629.82 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | (2Z,4Z)-2-but-1-enyl-4-methyl-3-[1-methyl-5-[4-(2-morpholin-4-ylethylamino)phenyl]pyrrol-2-yl]hexa-2,4-dienenitrile;rhenium |
| SMILES | C/C=C(C)\C(=C(C#N)/[C-]=C/CC)c1ccc(-c2ccc(NCCN3CCOCC3)cc2)n1C.[Re] |
| InChI | InChI=1S/C28H35N4O.Re/c1-5-7-8-24(21-29)28(22(3)6-2)27-14-13-26(31(27)4)23-9-11-25(12-10-23)30-15-16-32-17-19-33-20-18-32;/h6-7,9-14,30H,5,15-20H2,1-4H3;/q-1;/b22-6-,28-24-; |
| InChIKey | RNZMHKIEZOIFRH-MAHDXPCTSA-N |
| XLogP | 5.45 |
| TPSA | 53.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.82 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|