C23H25Cl2FN2O2 — CID 130381393
(3S,3'S,5'R)-6-chloro-3'-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1'-(cyclobutylmethyl)-5'-(hydroxymethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 130381393) has the molecular formula C23H25Cl2FN2O2 and a molecular weight of 451.37 g/mol. Its IUPAC name is (3S,3'S,5'R)-6-chloro-3'-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1'-(cyclobutylmethyl)-5'-(hydroxymethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,5'R)-6-chloro-3'-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1'-(cyclobutylmethyl)-5'-(hydroxymethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 130381393 |
| Molecular Formula | C23H25Cl2FN2O2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (3S,3'S,5'R)-6-chloro-3'-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1'-(cyclobutylmethyl)-5'-(hydroxymethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | C=C(Cl)/C=C\C=C(/F)[C@H]1C[C@H](CO)N(CC2CCC2)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C23H25Cl2FN2O2/c1-14(24)4-2-7-20(26)19-11-17(13-29)28(12-15-5-3-6-15)23(19)18-9-8-16(25)10-21(18)27-22(23)30/h2,4,7-10,15,17,19,29H,1,3,5-6,11-13H2,(H,27,30)/b4-2-,20-7-/t17-,19-,23-/m1/s1 |
| InChIKey | BDBOTIYPWXXYDQ-XQCFDPMVSA-N |
| XLogP | 5.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|