C18H22F2NO7P — CID 130391095
N-[(3R,4R)-3-fluoro-5-[[fluoro(phenoxy)phosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]-N-[(Z)-3-oxobut-1-enyl]acetamide (PubChem CID 130391095) has the molecular formula C18H22F2NO7P and a molecular weight of 433.34 g/mol. Its IUPAC name is N-[(3R,4R)-3-fluoro-5-[[fluoro(phenoxy)phosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]-N-[(Z)-3-oxobut-1-enyl]acetamide.
| Compound Name | N-[(3R,4R)-3-fluoro-5-[[fluoro(phenoxy)phosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]-N-[(Z)-3-oxobut-1-enyl]acetamide |
|---|---|
| PubChem CID | 130391095 |
| Molecular Formula | C18H22F2NO7P |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[(3R,4R)-3-fluoro-5-[[fluoro(phenoxy)phosphoryl]oxymethyl]-4-hydroxy-3-methyloxolan-2-yl]-N-[(Z)-3-oxobut-1-enyl]acetamide |
| SMILES | CC(=O)/C=C\N(C(C)=O)C1OC(CO[P@](=O)(F)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C18H22F2NO7P/c1-12(22)9-10-21(13(2)23)17-18(3,19)16(24)15(27-17)11-26-29(20,25)28-14-7-5-4-6-8-14/h4-10,15-17,24H,11H2,1-3H3/b10-9-/t15?,16-,17?,18-,29-/m1/s1 |
| InChIKey | PFOFXNLVTZIPIZ-VVVBSKFFSA-N |
| XLogP | 2.92 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|