C22H28O5S — CID 130413017
4-[2-(2,6-dimethoxy-4-prop-2-enylphenyl)sulfanyl-1-methoxypropyl]-2-methoxyphenol (PubChem CID 130413017) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is 4-[2-(2,6-dimethoxy-4-prop-2-enylphenyl)sulfanyl-1-methoxypropyl]-2-methoxyphenol.
| Compound Name | 4-[2-(2,6-dimethoxy-4-prop-2-enylphenyl)sulfanyl-1-methoxypropyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 130413017 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-[2-(2,6-dimethoxy-4-prop-2-enylphenyl)sulfanyl-1-methoxypropyl]-2-methoxyphenol |
| SMILES | C=CCc1cc(OC)c(SC(C)C(OC)c2ccc(O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C22H28O5S/c1-7-8-15-11-19(25-4)22(20(12-15)26-5)28-14(2)21(27-6)16-9-10-17(23)18(13-16)24-3/h7,9-14,21,23H,1,8H2,2-6H3 |
| InChIKey | PLCATBXGHMVHBY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|