C9H13N5 — CID 130426168
7-butylimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 130426168) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 7-butylimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-butylimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 130426168 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 7-butylimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCc1cnc2c(N)ncnn12 |
| InChI | InChI=1S/C9H13N5/c1-2-3-4-7-5-11-9-8(10)12-6-13-14(7)9/h5-6H,2-4H2,1H3,(H2,10,12,13) |
| InChIKey | RBKKTERPYMJNJK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |