C16H28O5 — CID 130429744
2-(hydroxymethyl)-2,3-bis(prop-2-enyl)pentane-1,5-diol;2-methylprop-2-enoic acid (PubChem CID 130429744) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2,3-bis(prop-2-enyl)pentane-1,5-diol;2-methylprop-2-enoic acid.
| Compound Name | 2-(hydroxymethyl)-2,3-bis(prop-2-enyl)pentane-1,5-diol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 130429744 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2-(hydroxymethyl)-2,3-bis(prop-2-enyl)pentane-1,5-diol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CCC(CCO)C(CO)(CO)CC=C |
| InChI | InChI=1S/C12H22O3.C4H6O2/c1-3-5-11(6-8-13)12(9-14,10-15)7-4-2;1-3(2)4(5)6/h3-4,11,13-15H,1-2,5-10H2;1H2,2H3,(H,5,6) |
| InChIKey | PKRZRDUVCDTDAC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|