C14H29NO2 — CID 130435972
[[3-(2,2,5,5-tetramethylheptan-4-yl)oxiran-2-yl]amino]methanol (PubChem CID 130435972) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is [[3-(2,2,5,5-tetramethylheptan-4-yl)oxiran-2-yl]amino]methanol.
| Compound Name | [[3-(2,2,5,5-tetramethylheptan-4-yl)oxiran-2-yl]amino]methanol |
|---|---|
| PubChem CID | 130435972 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | [[3-(2,2,5,5-tetramethylheptan-4-yl)oxiran-2-yl]amino]methanol |
| SMILES | CCC(C)(C)C(CC(C)(C)C)C1OC1NCO |
| InChI | InChI=1S/C14H29NO2/c1-7-14(5,6)10(8-13(2,3)4)11-12(17-11)15-9-16/h10-12,15-16H,7-9H2,1-6H3 |
| InChIKey | JUZOEPDZEJENJP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|