C15H34Si — CID 123719554
[2-(2,2-dimethylpropyl)-3,3-dimethylpentyl]-trimethylsilane (PubChem CID 123719554) has the molecular formula C15H34Si and a molecular weight of 242.52 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)-3,3-dimethylpentyl]-trimethylsilane.
| Compound Name | [2-(2,2-dimethylpropyl)-3,3-dimethylpentyl]-trimethylsilane |
|---|---|
| PubChem CID | 123719554 |
| Molecular Formula | C15H34Si |
| Molecular Weight | 242.52 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | [2-(2,2-dimethylpropyl)-3,3-dimethylpentyl]-trimethylsilane |
| SMILES | CCC(C)(C)C(CC(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C15H34Si/c1-10-15(5,6)13(11-14(2,3)4)12-16(7,8)9/h13H,10-12H2,1-9H3 |
| InChIKey | VYRJSDZXTNUZNJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|