C13H13N3O2S — CID 130438596
5-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-1,2,3-benzothiadiazole-6-carboxylic acid (PubChem CID 130438596) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-1,2,3-benzothiadiazole-6-carboxylic acid.
| Compound Name | 5-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-1,2,3-benzothiadiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 130438596 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-1,2,3-benzothiadiazole-6-carboxylic acid |
| SMILES | C/C=C\C(=C/C)Nc1cc2nnsc2cc1C(=O)O |
| InChI | InChI=1S/C13H13N3O2S/c1-3-5-8(4-2)14-10-7-11-12(19-16-15-11)6-9(10)13(17)18/h3-7,14H,1-2H3,(H,17,18)/b5-3-,8-4+ |
| InChIKey | LLLBHBUHWRDQCI-VOGDQUTBSA-N |
| XLogP | 3.28 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|