C11H14Br2N2 — CID 130440900
N'-[(E)-but-2-en-2-yl]-N-(2,5-dibromophenyl)methanediamine (PubChem CID 130440900) has the molecular formula C11H14Br2N2 and a molecular weight of 334.06 g/mol. Its IUPAC name is N'-[(E)-but-2-en-2-yl]-N-(2,5-dibromophenyl)methanediamine.
| Compound Name | N'-[(E)-but-2-en-2-yl]-N-(2,5-dibromophenyl)methanediamine |
|---|---|
| PubChem CID | 130440900 |
| Molecular Formula | C11H14Br2N2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | N'-[(E)-but-2-en-2-yl]-N-(2,5-dibromophenyl)methanediamine |
| SMILES | C/C=C(\C)NCNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br2N2/c1-3-8(2)14-7-15-11-6-9(12)4-5-10(11)13/h3-6,14-15H,7H2,1-2H3/b8-3+ |
| InChIKey | DSLQHBQYXAYTAE-FPYGCLRLSA-N |
| XLogP | 4.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|