C16H32N2S — CID 130458823
(3Z,5Z)-5-ethyl-N-[2-(ethylaminomethylsulfanyl)propyl]-N-methylhepta-3,5-dien-1-amine (PubChem CID 130458823) has the molecular formula C16H32N2S and a molecular weight of 284.51 g/mol. Its IUPAC name is (3Z,5Z)-5-ethyl-N-[2-(ethylaminomethylsulfanyl)propyl]-N-methylhepta-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-5-ethyl-N-[2-(ethylaminomethylsulfanyl)propyl]-N-methylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 130458823 |
| Molecular Formula | C16H32N2S |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (3Z,5Z)-5-ethyl-N-[2-(ethylaminomethylsulfanyl)propyl]-N-methylhepta-3,5-dien-1-amine |
| SMILES | C/C=C(\C=C/CCN(C)CC(C)SCNCC)CC |
| InChI | InChI=1S/C16H32N2S/c1-6-16(7-2)11-9-10-12-18(5)13-15(4)19-14-17-8-3/h6,9,11,15,17H,7-8,10,12-14H2,1-5H3/b11-9-,16-6- |
| InChIKey | VMJSZJZKLYDHKM-SIHNCKKUSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|