About 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate
1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate (PubChem CID 130459046) has the molecular formula C19H30O8
and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate.
Molecular Properties
| Compound Name | 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate |
| PubChem CID | 130459046 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate |
| SMILES | C=C(C(=O)OC(C)C)C(=O)OC(C)CCC(C)OC(=O)CC(=O)OC(C)C |
| InChI | InChI=1S/C19H30O8/c1-11(2)24-16(20)10-17(21)26-13(5)8-9-14(6)27-19(23)15(7)18(22)25-12(3)4/h11-14H,7-10H2,1-6H3 |
| InChIKey | PNSKVWBBNUELSD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate?
The IUPAC name of 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate (CID 130459046) is 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate.
What is the SMILES notation for 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate?
The canonical SMILES for 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate is C=C(C(=O)OC(C)C)C(=O)OC(C)CCC(C)OC(=O)CC(=O)OC(C)C.
What is the InChIKey of 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate?
The InChIKey is PNSKVWBBNUELSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O8/c1-11(2)24-16(20)10-17(21)26-13(5)8-9-14(6)27-19(23)15(7)18(22)25-12(3)4/h11-14H,7-10H2,1-6H3.
What are the key properties of 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate?
1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate has a molecular weight of 386.44 g/mol, XLogP of 2.48, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[5-(3-oxo-3-propan-2-yloxypropanoyl)oxyhexan-2-yl] 3-O-propan-2-yl 2-methylidenepropanedioate is sourced from PubChem (CID 130459046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).