C23H32N4O3 — CID 130460166
tert-butyl 4-(4-acetyl-1-cyclopentylindazol-6-yl)piperazine-1-carboxylate (PubChem CID 130460166) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl 4-(4-acetyl-1-cyclopentylindazol-6-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-acetyl-1-cyclopentylindazol-6-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 130460166 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl 4-(4-acetyl-1-cyclopentylindazol-6-yl)piperazine-1-carboxylate |
| SMILES | CC(=O)c1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc2c1cnn2C1CCCC1 |
| InChI | InChI=1S/C23H32N4O3/c1-16(28)19-13-18(14-21-20(19)15-24-27(21)17-7-5-6-8-17)25-9-11-26(12-10-25)22(29)30-23(2,3)4/h13-15,17H,5-12H2,1-4H3 |
| InChIKey | NQBWJHFOCYWCGT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |