C17H11F6O6P — CID 130463914
4-bis[2-(trifluoromethyl)phenoxy]phosphoryl-1,3-dioxolan-2-one (PubChem CID 130463914) has the molecular formula C17H11F6O6P and a molecular weight of 456.23 g/mol. Its IUPAC name is 4-bis[2-(trifluoromethyl)phenoxy]phosphoryl-1,3-dioxolan-2-one.
| Compound Name | 4-bis[2-(trifluoromethyl)phenoxy]phosphoryl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 130463914 |
| Molecular Formula | C17H11F6O6P |
| Molecular Weight | 456.23 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 4-bis[2-(trifluoromethyl)phenoxy]phosphoryl-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(P(=O)(Oc2ccccc2C(F)(F)F)Oc2ccccc2C(F)(F)F)O1 |
| InChI | InChI=1S/C17H11F6O6P/c18-16(19,20)10-5-1-3-7-12(10)28-30(25,14-9-26-15(24)27-14)29-13-8-4-2-6-11(13)17(21,22)23/h1-8,14H,9H2 |
| InChIKey | CCCOQGJHJQBDSU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.23 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|