C25H26N4O — CID 130465524
1-methyl-N-[[5-(3-methylphenyl)isoquinolin-8-yl]methyl]-3-propylpyrazole-5-carboxamide (PubChem CID 130465524) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-methyl-N-[[5-(3-methylphenyl)isoquinolin-8-yl]methyl]-3-propylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[[5-(3-methylphenyl)isoquinolin-8-yl]methyl]-3-propylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 130465524 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-methyl-N-[[5-(3-methylphenyl)isoquinolin-8-yl]methyl]-3-propylpyrazole-5-carboxamide |
| SMILES | CCCc1cc(C(=O)NCc2ccc(-c3cccc(C)c3)c3ccncc23)n(C)n1 |
| InChI | InChI=1S/C25H26N4O/c1-4-6-20-14-24(29(3)28-20)25(30)27-15-19-9-10-21(18-8-5-7-17(2)13-18)22-11-12-26-16-23(19)22/h5,7-14,16H,4,6,15H2,1-3H3,(H,27,30) |
| InChIKey | ZQOOBRAAOZRLNZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |