C28H34Cl2N4 — CID 130474249
N'-[3-[(1Z)-3-chlorobuta-1,3-dienyl]-2-methyl-4-pyridinyl]-N-(7-chloroquinolin-4-yl)nonane-1,9-diamine (PubChem CID 130474249) has the molecular formula C28H34Cl2N4 and a molecular weight of 497.51 g/mol. Its IUPAC name is N'-[3-[(1Z)-3-chlorobuta-1,3-dienyl]-2-methyl-4-pyridinyl]-N-(7-chloroquinolin-4-yl)nonane-1,9-diamine.
| Compound Name | N'-[3-[(1Z)-3-chlorobuta-1,3-dienyl]-2-methyl-4-pyridinyl]-N-(7-chloroquinolin-4-yl)nonane-1,9-diamine |
|---|---|
| PubChem CID | 130474249 |
| Molecular Formula | C28H34Cl2N4 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N'-[3-[(1Z)-3-chlorobuta-1,3-dienyl]-2-methyl-4-pyridinyl]-N-(7-chloroquinolin-4-yl)nonane-1,9-diamine |
| SMILES | C=C(Cl)/C=C\c1c(NCCCCCCCCCNc2ccnc3cc(Cl)ccc23)ccnc1C |
| InChI | InChI=1S/C28H34Cl2N4/c1-21(29)10-12-24-22(2)31-18-14-26(24)32-16-8-6-4-3-5-7-9-17-33-27-15-19-34-28-20-23(30)11-13-25(27)28/h10-15,18-20H,1,3-9,16-17H2,2H3,(H,31,32)(H,33,34)/b12-10- |
| InChIKey | GNFZZVIGGXMTTO-BENRWUELSA-N |
| XLogP | 8.61 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|