C9H14ClN5 — CID 130568349
6-(2-chloroethyl)-2-N-(1-methylcyclopropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 130568349) has the molecular formula C9H14ClN5 and a molecular weight of 227.70 g/mol. Its IUPAC name is 6-(2-chloroethyl)-2-N-(1-methylcyclopropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloroethyl)-2-N-(1-methylcyclopropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130568349 |
| Molecular Formula | C9H14ClN5 |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 6-(2-chloroethyl)-2-N-(1-methylcyclopropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(Nc2nc(N)nc(CCCl)n2)CC1 |
| InChI | InChI=1S/C9H14ClN5/c1-9(3-4-9)15-8-13-6(2-5-10)12-7(11)14-8/h2-5H2,1H3,(H3,11,12,13,14,15) |
| InChIKey | JWSGADZSBFHEEC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|