C11H12F9N5 — CID 139724195
2-N-ethyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,3,5-triazine-2,4-diamine (PubChem CID 139724195) has the molecular formula C11H12F9N5 and a molecular weight of 385.23 g/mol. Its IUPAC name is 2-N-ethyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-ethyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139724195 |
| Molecular Formula | C11H12F9N5 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-N-ethyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(N)nc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F9N5/c1-2-22-7-24-5(23-6(21)25-7)3-4-8(12,13)9(14,15)10(16,17)11(18,19)20/h2-4H2,1H3,(H3,21,22,23,24,25) |
| InChIKey | CMMXLLGERGPNHP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|