C7H13N — CID 130642169
(3R,4R)-4-methylhex-1-yn-3-amine (PubChem CID 130642169) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is (3R,4R)-4-methylhex-1-yn-3-amine.
| Compound Name | (3R,4R)-4-methylhex-1-yn-3-amine |
|---|---|
| PubChem CID | 130642169 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (3R,4R)-4-methylhex-1-yn-3-amine |
| SMILES | C#C[C@H](N)[C@H](C)CC |
| InChI | InChI=1S/C7H13N/c1-4-6(3)7(8)5-2/h2,6-7H,4,8H2,1,3H3/t6-,7+/m1/s1 |
| InChIKey | VOCRJRSSMUVEOT-RQJHMYQMSA-N |
| XLogP | 0.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|