C7H14N2 — CID 163613012
3-ethylpent-4-yne-1,2-diamine (PubChem CID 163613012) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 3-ethylpent-4-yne-1,2-diamine.
| Compound Name | 3-ethylpent-4-yne-1,2-diamine |
|---|---|
| PubChem CID | 163613012 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 3-ethylpent-4-yne-1,2-diamine |
| SMILES | C#CC(CC)C(N)CN |
| InChI | InChI=1S/C7H14N2/c1-3-6(4-2)7(9)5-8/h1,6-7H,4-5,8-9H2,2H3 |
| InChIKey | HHOQFDDSJLKAQZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|