C8H13NO — CID 171526477
(3S,4R)-3-amino-4-ethylhex-5-yn-2-one (PubChem CID 171526477) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-ethylhex-5-yn-2-one.
| Compound Name | (3S,4R)-3-amino-4-ethylhex-5-yn-2-one |
|---|---|
| PubChem CID | 171526477 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3S,4R)-3-amino-4-ethylhex-5-yn-2-one |
| SMILES | C#C[C@@H](CC)[C@H](N)C(C)=O |
| InChI | InChI=1S/C8H13NO/c1-4-7(5-2)8(9)6(3)10/h1,7-8H,5,9H2,2-3H3/t7-,8+/m0/s1 |
| InChIKey | CNMCQLJMBYEWFL-JGVFFNPUSA-N |
| XLogP | 0.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|