About 2-ethylbut-3-yne-1-thiol
2-ethylbut-3-yne-1-thiol (PubChem CID 57216004) has the molecular formula C6H10S
and a molecular weight of 114.21 g/mol. Its IUPAC name is 2-ethylbut-3-yne-1-thiol.
Molecular Properties
| Compound Name | 2-ethylbut-3-yne-1-thiol |
| PubChem CID | 57216004 |
| Molecular Formula | C6H10S |
| Molecular Weight | 114.21 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | 2-ethylbut-3-yne-1-thiol |
| SMILES | C#CC(CC)CS |
| InChI | InChI=1S/C6H10S/c1-3-6(4-2)5-7/h1,6-7H,4-5H2,2H3 |
| InChIKey | YFQKVJCHSYCGJS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbut-3-yne-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbut-3-yne-1-thiol?
The IUPAC name of 2-ethylbut-3-yne-1-thiol (CID 57216004) is 2-ethylbut-3-yne-1-thiol.
What is the SMILES notation for 2-ethylbut-3-yne-1-thiol?
The canonical SMILES for 2-ethylbut-3-yne-1-thiol is C#CC(CC)CS.
What is the InChIKey of 2-ethylbut-3-yne-1-thiol?
The InChIKey is YFQKVJCHSYCGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10S/c1-3-6(4-2)5-7/h1,6-7H,4-5H2,2H3.
What are the key properties of 2-ethylbut-3-yne-1-thiol?
2-ethylbut-3-yne-1-thiol has a molecular weight of 114.21 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbut-3-yne-1-thiol is sourced from PubChem (CID 57216004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).