C7H7N3O2S — CID 130649631
N-(2-cyanoethyl)-2-oxo-3H-1,3-thiazole-4-carboxamide (PubChem CID 130649631) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-oxo-3H-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-2-oxo-3H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 130649631 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | N-(2-cyanoethyl)-2-oxo-3H-1,3-thiazole-4-carboxamide |
| SMILES | N#CCCNC(=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H7N3O2S/c8-2-1-3-9-6(11)5-4-13-7(12)10-5/h4H,1,3H2,(H,9,11)(H,10,12) |
| InChIKey | LPKPZCRXXABHEP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|