C9H14N2S — CID 130666288
1-(2-methylcyclobutyl)-3-prop-2-ynylthiourea (PubChem CID 130666288) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 1-(2-methylcyclobutyl)-3-prop-2-ynylthiourea.
| Compound Name | 1-(2-methylcyclobutyl)-3-prop-2-ynylthiourea |
|---|---|
| PubChem CID | 130666288 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-(2-methylcyclobutyl)-3-prop-2-ynylthiourea |
| SMILES | C#CCNC(=S)NC1CCC1C |
| InChI | InChI=1S/C9H14N2S/c1-3-6-10-9(12)11-8-5-4-7(8)2/h1,7-8H,4-6H2,2H3,(H2,10,11,12) |
| InChIKey | YJIRVXBJMJCIGE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|