C18H14N2O2 — CID 130674400
2-[4-(3-aminoprop-1-ynyl)-3-methylphenyl]isoindole-1,3-dione (PubChem CID 130674400) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[4-(3-aminoprop-1-ynyl)-3-methylphenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(3-aminoprop-1-ynyl)-3-methylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130674400 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[4-(3-aminoprop-1-ynyl)-3-methylphenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)c3ccccc3C2=O)ccc1C#CCN |
| InChI | InChI=1S/C18H14N2O2/c1-12-11-14(9-8-13(12)5-4-10-19)20-17(21)15-6-2-3-7-16(15)18(20)22/h2-3,6-9,11H,10,19H2,1H3 |
| InChIKey | MPCSESRDRJHBJN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|