C8H11ClN4O — CID 130693411
6-chloro-5-[(1S)-1,2-diaminoethyl]pyridine-3-carboxamide (PubChem CID 130693411) has the molecular formula C8H11ClN4O and a molecular weight of 214.66 g/mol. Its IUPAC name is 6-chloro-5-[(1S)-1,2-diaminoethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-5-[(1S)-1,2-diaminoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 130693411 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 6-chloro-5-[(1S)-1,2-diaminoethyl]pyridine-3-carboxamide |
| SMILES | NC[C@@H](N)c1cc(C(N)=O)cnc1Cl |
| InChI | InChI=1S/C8H11ClN4O/c9-7-5(6(11)2-10)1-4(3-13-7)8(12)14/h1,3,6H,2,10-11H2,(H2,12,14)/t6-/m1/s1 |
| InChIKey | RDDLDOVHXJNGJP-ZCFIWIBFSA-N |
| XLogP | -0.21 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|