C8H11NOS3 — CID 130736494
1,4-dithian-2-yl(1,2-thiazol-3-yl)methanol (PubChem CID 130736494) has the molecular formula C8H11NOS3 and a molecular weight of 233.38 g/mol. Its IUPAC name is 1,4-dithian-2-yl(1,2-thiazol-3-yl)methanol.
| Compound Name | 1,4-dithian-2-yl(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130736494 |
| Molecular Formula | C8H11NOS3 |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 1,4-dithian-2-yl(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)C1CSCCS1 |
| InChI | InChI=1S/C8H11NOS3/c10-8(6-1-2-13-9-6)7-5-11-3-4-12-7/h1-2,7-8,10H,3-5H2 |
| InChIKey | KGLXZPSMRPYAQZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |