C20H22Cl2O5S — CID 13073916
[(2R,6R)-6-[(2,4-dichlorophenyl)methoxy]oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 13073916) has the molecular formula C20H22Cl2O5S and a molecular weight of 445.36 g/mol. Its IUPAC name is [(2R,6R)-6-[(2,4-dichlorophenyl)methoxy]oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,6R)-6-[(2,4-dichlorophenyl)methoxy]oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13073916 |
| Molecular Formula | C20H22Cl2O5S |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | [(2R,6R)-6-[(2,4-dichlorophenyl)methoxy]oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CCC[C@H](OCc3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C20H22Cl2O5S/c1-14-5-9-18(10-6-14)28(23,24)26-13-17-3-2-4-20(27-17)25-12-15-7-8-16(21)11-19(15)22/h5-11,17,20H,2-4,12-13H2,1H3/t17-,20-/m1/s1 |
| InChIKey | KGYDYYQXZDBAQM-YLJYHZDGSA-N |
| XLogP | 5.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|