C13H17N — CID 130765038
(1R,9S)-tricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-amine (PubChem CID 130765038) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (1R,9S)-tricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-amine.
| Compound Name | (1R,9S)-tricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-amine |
|---|---|
| PubChem CID | 130765038 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (1R,9S)-tricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-amine |
| SMILES | NC1c2ccccc2[C@@H]2CCC[C@H]1C2 |
| InChI | InChI=1S/C13H17N/c14-13-10-5-3-4-9(8-10)11-6-1-2-7-12(11)13/h1-2,6-7,9-10,13H,3-5,8,14H2/t9-,10+,13?/m1/s1 |
| InChIKey | JWPBZCOXWNSKNW-GDVCOKDOSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |