C10H13ClFN3 — CID 130834678
2-chloro-5-fluoro-N-(1-propylcyclopropyl)pyrimidin-4-amine (PubChem CID 130834678) has the molecular formula C10H13ClFN3 and a molecular weight of 229.69 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(1-propylcyclopropyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-(1-propylcyclopropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 130834678 |
| Molecular Formula | C10H13ClFN3 |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-chloro-5-fluoro-N-(1-propylcyclopropyl)pyrimidin-4-amine |
| SMILES | CCCC1(Nc2nc(Cl)ncc2F)CC1 |
| InChI | InChI=1S/C10H13ClFN3/c1-2-3-10(4-5-10)15-8-7(12)6-13-9(11)14-8/h6H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | YCVZXMGFXSMOLD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |