About N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide
N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 130841255) has the molecular formula C8H11FN2OS
and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide.
Molecular Properties
| Compound Name | N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide |
| PubChem CID | 130841255 |
| Molecular Formula | C8H11FN2OS |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1nc(C)c(F)s1 |
| InChI | InChI=1S/C8H11FN2OS/c1-3-4-6(12)11-8-10-5(2)7(9)13-8/h3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | YCQQPWPNCQANHK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide?
The IUPAC name of N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide (CID 130841255) is N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide.
What is the SMILES notation for N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide?
The canonical SMILES for N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide is CCCC(=O)Nc1nc(C)c(F)s1.
What is the InChIKey of N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide?
The InChIKey is YCQQPWPNCQANHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2OS/c1-3-4-6(12)11-8-10-5(2)7(9)13-8/h3-4H2,1-2H3,(H,10,11,12).
What are the key properties of N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide?
N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide has a molecular weight of 202.25 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)butanamide is sourced from PubChem (CID 130841255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).