C9H14ClNO2 — CID 130870380
[(1S,3S,5S,6R)-3-chloro-8-azabicyclo[3.2.1]octan-6-yl] acetate (PubChem CID 130870380) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is [(1S,3S,5S,6R)-3-chloro-8-azabicyclo[3.2.1]octan-6-yl] acetate.
| Compound Name | [(1S,3S,5S,6R)-3-chloro-8-azabicyclo[3.2.1]octan-6-yl] acetate |
|---|---|
| PubChem CID | 130870380 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | [(1S,3S,5S,6R)-3-chloro-8-azabicyclo[3.2.1]octan-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C[C@H](Cl)C[C@@H]1N2 |
| InChI | InChI=1S/C9H14ClNO2/c1-5(12)13-9-4-7-2-6(10)3-8(9)11-7/h6-9,11H,2-4H2,1H3/t6-,7+,8-,9+/m0/s1 |
| InChIKey | WVHNZGAMOOSDLB-UYXSQOIJSA-N |
| XLogP | 1.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|