C26H31O2P — CID 13087581
[2,3-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylphosphane (PubChem CID 13087581) has the molecular formula C26H31O2P and a molecular weight of 406.51 g/mol. Its IUPAC name is [2,3-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylphosphane.
| Compound Name | [2,3-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 13087581 |
| Molecular Formula | C26H31O2P |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [2,3-bis[(2-methylpropan-2-yl)oxy]phenyl]-diphenylphosphane |
| SMILES | CC(C)(C)Oc1cccc(P(c2ccccc2)c2ccccc2)c1OC(C)(C)C |
| InChI | InChI=1S/C26H31O2P/c1-25(2,3)27-22-18-13-19-23(24(22)28-26(4,5)6)29(20-14-9-7-10-15-20)21-16-11-8-12-17-21/h7-19H,1-6H3 |
| InChIKey | IZTMISGYKBEAGR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|