About 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine
1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine (PubChem CID 130941718) has the molecular formula C8H12BrN3O
and a molecular weight of 246.11 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine |
| PubChem CID | 130941718 |
| Molecular Formula | C8H12BrN3O |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1ccc(Br)o1 |
| InChI | InChI=1S/C8H12BrN3O/c1-10-8(11-2)12-5-6-3-4-7(9)13-6/h3-4H,5H2,1-2H3,(H2,10,11,12) |
| InChIKey | IUFVHVUZDZHVCS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine?
The IUPAC name of 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine (CID 130941718) is 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine.
What is the SMILES notation for 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine?
The canonical SMILES for 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine is C/N=C(\NC)NCc1ccc(Br)o1.
What is the InChIKey of 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine?
The InChIKey is IUFVHVUZDZHVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrN3O/c1-10-8(11-2)12-5-6-3-4-7(9)13-6/h3-4H,5H2,1-2H3,(H2,10,11,12).
What are the key properties of 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine?
1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine has a molecular weight of 246.11 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromofuran-2-yl)methyl]-2,3-dimethylguanidine is sourced from PubChem (CID 130941718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).