C8H10N4O — CID 130979898
1-(1H-pyrrol-2-yl)-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 130979898) has the molecular formula C8H10N4O and a molecular weight of 178.20 g/mol. Its IUPAC name is 1-(1H-pyrrol-2-yl)-2-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | 1-(1H-pyrrol-2-yl)-2-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 130979898 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 1-(1H-pyrrol-2-yl)-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | OC(Cn1cncn1)c1ccc[nH]1 |
| InChI | InChI=1S/C8H10N4O/c13-8(7-2-1-3-10-7)4-12-6-9-5-11-12/h1-3,5-6,8,10,13H,4H2 |
| InChIKey | POKFXUBAZMYWHH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |