C7H8N4OS — CID 130871558
1-(1,2-thiazol-5-yl)-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 130871558) has the molecular formula C7H8N4OS and a molecular weight of 196.24 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-yl)-2-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | 1-(1,2-thiazol-5-yl)-2-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 130871558 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 1-(1,2-thiazol-5-yl)-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | OC(Cn1cncn1)c1ccns1 |
| InChI | InChI=1S/C7H8N4OS/c12-6(7-1-2-10-13-7)3-11-5-8-4-9-11/h1-2,4-6,12H,3H2 |
| InChIKey | PLNDSIINZVWPLH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |