C9H14N2S2 — CID 131089612
5-ethyl-N-(thiolan-3-yl)-1,3-thiazol-2-amine (PubChem CID 131089612) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is 5-ethyl-N-(thiolan-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-ethyl-N-(thiolan-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131089612 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 5-ethyl-N-(thiolan-3-yl)-1,3-thiazol-2-amine |
| SMILES | CCc1cnc(NC2CCSC2)s1 |
| InChI | InChI=1S/C9H14N2S2/c1-2-8-5-10-9(13-8)11-7-3-4-12-6-7/h5,7H,2-4,6H2,1H3,(H,10,11) |
| InChIKey | NQESJFNYMJESML-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |